CAS:29509-91-9|4-Chloro-2,6-diphenylpyrimidine
Molecular Formula:C16H11ClN2
Molecular Weight:266.73g/mol
Purity:98 percent
Package:5g/10g/25g/50g/bulk package
- Dosbarthu ledled y byd
- Sicrwydd Ansawdd
- Gwasanaeth Cwsmer 24/7
Cyflwyniad Cynnyrch
4-Chloro-2,6-diphenylpyrimidine(CAS:29509-91-9) has a number of scientific research applications. It has been used as a reagent for the synthesis of a variety of heterocyclic compounds, including pyrimidines, pyrazines, and quinolines. It has also been used in the synthesis of organometallic compounds and as an intermediate in the production of pharmaceuticals and other compounds. Additionally, 4-Cl-2,6-Dpp has been used as a catalyst in organic synthesis and as a ligand in coordination chemistry.
|
|
|
| 4-chloro-2,6-diphenylpyrimidine | |
| MFCD00234890 | |
| 339.2 degree | |
| 104-105 degree | |
| 189.4±11.5 degree | |
| 1.221g/cm3 | |
| 25.78 | |
| 4.89 | |
| White to off-white (Solid) | |
| {{0}}.0±0.7 mmHg at 25 degree | |
| 1.618 | |
| InChI=1S/C16H11ClN2/c17-15-11-14(12-7-3-1-4-8-12)18-16(19-15)13-9-5-2-6-10-13/h1-11H | |
| MJDDVTZXYXHTRY-UHFFFAOYSA-N |
Tagiau poblogaidd: cas:29509-91-9|4-chloro-2,6-diphenylpyrimidine, price, quotation, discount, in stock, for sale
